CAS 1423023-99-7

Benzeneacetic acid, 3,5-dichloro-α-(methylamino)-, hydrochloride (1:1)

Description:

Benzeneacetic acid, 3,5-dichloro-α-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzene ring substituted with a dichloro group and an acetic acid moiety. The presence of the α-(methylamino) group indicates that it has an amino functional group attached to the carbon adjacent to the carboxylic acid. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The dichloro substitutions suggest potential applications in medicinal chemistry, as halogenated compounds often exhibit unique pharmacological properties. The compound's molecular interactions may involve hydrogen bonding due to the carboxylic acid and amino groups, making it relevant in various biochemical contexts. Additionally, the presence of chlorine atoms can affect the compound's reactivity and stability. Overall, this substance may be of interest in research related to pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further studies and evaluations.

Formula: C₉H₉Cl₂NO₂·ClH

InChI: InChI=1S/C9H9Cl2NO2.ClH/c1-12-8(9(13)14)5-2-6(10)4-7(11)3-5;/h2-4,8,12H,1H3,(H,13,14);1H

InChI key: InChIKey=IINNBWSHLLQYFH-UHFFFAOYSA-N

SMILES: C(C(O)=O)(NC)C1=CC(Cl)=CC(Cl)=C1.Cl

Synonyms:

• Benzeneacetic acid, 3,5-dichloro-α-(methylamino)-, hydrochloride (1:1)

2-(3,5-Dichlorophenyl)-2-(methylamino)acetic acid hydrochloride

CAS: 1423023-99-7

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₃NO₂

Purity: Min. 95%

Molecular weight: 270.5 g/mol

Ref: 3D-YGC02399