CAS 1423024-02-5

Benzeneacetamide, α-amino-N-methyl-N-(3-thienylmethyl)-, hydrochloride (1:1)

Description:

Benzeneacetamide, α-amino-N-methyl-N-(3-thienylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from benzene and contains both an amino group and a thienylmethyl substituent. This compound features a benzene ring attached to an acetamide moiety, with a methyl group on the nitrogen atom of the amine, enhancing its lipophilicity. The presence of the thienyl group, a five-membered aromatic ring containing sulfur, contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical applications. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. However, specific biological activity, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.

Formula: C₁₄H₁₆N₂OS·ClH

InChI: InChI=1S/C14H16N2OS.ClH/c1-16(9-11-7-8-18-10-11)14(17)13(15)12-5-3-2-4-6-12;/h2-8,10,13H,9,15H2,1H3;1H

InChI key: InChIKey=FJAZKTQBIDNSQF-UHFFFAOYSA-N

SMILES: C(C(N(CC=1C=CSC1)C)=O)(N)C2=CC=CC=C2.Cl

Synonyms:

• Benzeneacetamide, α-amino-N-methyl-N-(3-thienylmethyl)-, hydrochloride (1:1)

2-Amino-N-methyl-2-phenyl-N-(thiophen-3-ylmethyl)acetamide hydrochloride

CAS: 1423024-02-5

Versatile small molecule scaffold

Formula: C₁₄H₁₇ClN₂OS

Purity: Min. 95%

Molecular weight: 296.8 g/mol

Ref: 3D-YGC02402