CAS 1423024-06-9

Benzamide, 4-amino-2-chloro-N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2)

Description:

Benzamide, 4-amino-2-chloro-N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a benzamide core with an amino group and a chloro substituent at specific positions on the aromatic ring. The presence of a dimethylaminoethyl side chain enhances its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. Its CAS number, 1423024-06-9, allows for precise identification in chemical databases. Safety data sheets would provide information on handling, toxicity, and environmental impact, which are crucial for laboratory and industrial use. Overall, this compound represents a unique combination of functional groups that may contribute to its reactivity and utility in chemical research.

Formula: C₁₁H₁₆ClN₃O·2ClH

InChI: InChI=1S/C11H16ClN3O.2ClH/c1-15(2)6-5-14-11(16)9-4-3-8(13)7-10(9)12;;/h3-4,7H,5-6,13H2,1-2H3,(H,14,16);2*1H

InChI key: InChIKey=XNEBRNCHPMHAAZ-UHFFFAOYSA-N

SMILES: C(NCCN(C)C)(=O)C1=C(Cl)C=C(N)C=C1.Cl

Synonyms:

• Benzamide, 4-amino-2-chloro-N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2)

4-Amino-2-chloro-N-[2-(dimethylamino)ethyl]benzamide dihydrochloride

CAS: 1423024-06-9

Versatile small molecule scaffold

Formula: C₁₁H₁₈Cl₃N₃O

Purity: Min. 95%

Molecular weight: 314.6 g/mol

Ref: 3D-YGC02406