CAS 1423024-20-7

2-Pyrrolidinone, 3-(methylamino)-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 3-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This substance is a hydrochloride salt, indicating that it is the hydrochloric acid salt of the base compound, which enhances its solubility in water. The presence of a methylamino group suggests that it has potential basic properties, which can influence its reactivity and interaction with other chemical species. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for hydrogen bonding, which can affect its physical properties such as melting point and solubility. Additionally, the compound may be utilized in various applications, including as an intermediate in organic synthesis or in the development of therapeutic agents. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula: C₅H₁₀N₂O·ClH

InChI: InChI=1S/C5H10N2O.ClH/c1-6-4-2-3-7-5(4)8;/h4,6H,2-3H2,1H3,(H,7,8);1H

InChI key: InChIKey=PHRDDAKZHVJOGS-UHFFFAOYSA-N

SMILES: N(C)C1C(=O)NCC1.Cl

Synonyms:

• 2-Pyrrolidinone, 3-(methylamino)-, hydrochloride (1:1)

3-(Methylamino)pyrrolidin-2-one hydrochloride

CAS: 1423024-20-7

Versatile small molecule scaffold

Formula: C₅H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 150.61 g/mol

Ref: 3D-YGC02420