CAS 1423024-34-3

8-Azabicyclo[3.2.1]oct-2-ene, hydrochloride (1:1)

Description:

8-Azabicyclo[3.2.1]oct-2-ene, hydrochloride (1:1) is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom incorporated into the ring system. This compound features a bicyclic framework that consists of a seven-membered ring and a five-membered ring, with a double bond present in the structure. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the nitrogen atom contributes to its basicity and potential biological activity, which may include interactions with neurotransmitter systems. As a hydrochloride salt, it typically exhibits improved stability and handling properties compared to its free base form. This compound may be of interest in medicinal chemistry for its potential use in drug development, particularly in the synthesis of compounds targeting specific biological pathways. However, detailed studies on its pharmacological properties and safety profile would be necessary for any therapeutic applications.

Formula: C₇H₁₁N·ClH

InChI: InChI=1S/C7H11N.ClH/c1-2-6-4-5-7(3-1)8-6;/h1-2,6-8H,3-5H2;1H

InChI key: InChIKey=LSUMTEMFIXRQAM-UHFFFAOYSA-N

SMILES: C12NC(CC1)C=CC2.Cl

Synonyms:

• 8-Azabicyclo[3.2.1]oct-2-ene, hydrochloride (1:1)

8-azabicyclo[3.2.1]oct-2-ene hydrochloride

CAS: 1423024-34-3

Formula: C₇H₁₂ClN

Purity: 95.0%

Molecular weight: 145.63

Ref: 10-F496534