CAS 1423024-51-4

Benzeneacetic acid, α-(dimethylamino)-2,6-difluoro-, hydrochloride (1:1)

Description:

Benzeneacetic acid, α-(dimethylamino)-2,6-difluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with an acetic acid group and a dimethylamino group, along with two fluorine atoms at the 2 and 6 positions of the benzene ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the dimethylamino group suggests potential basic properties, while the difluorination can impart distinctive electronic and steric effects, potentially affecting its reactivity and interaction with biological targets. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular weight, melting point, and specific solubility characteristics would be determined through experimental methods. As with many fluorinated compounds, it may also display unique stability and lipophilicity, which can influence its behavior in biological systems and its application in drug development.

Formula: C₁₀H₁₁F₂NO₂·ClH

InChI: InChI=1S/C10H11F2NO2.ClH/c1-13(2)9(10(14)15)8-6(11)4-3-5-7(8)12;/h3-5,9H,1-2H3,(H,14,15);1H

InChI key: InChIKey=GEMSEDUCAACKKZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N(C)C)C1=C(F)C=CC=C1F.Cl

Synonyms:

• Benzeneacetic acid, α-(dimethylamino)-2,6-difluoro-, hydrochloride (1:1)

2-(2,6-Difluorophenyl)-2-(dimethylamino)acetic acid hydrochloride

CAS: 1423024-51-4

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClF₂NO₂

Purity: Min. 95%

Molecular weight: 251.66 g/mol

Ref: 3D-YGC02451