CAS 1423024-55-8

Pentanoic acid, 5-amino-4-methyl-, hydrochloride (1:1)

Description:

Pentanoic acid, 5-amino-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a pentanoic acid backbone with an amino group and a methyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of the amino group suggests that it may exhibit basic properties, while the carboxylic acid group contributes to its acidic characteristics. This dual functionality allows it to participate in various chemical reactions, including those typical of amino acids and carboxylic acids. The hydrochloride form indicates that the compound is protonated, which can influence its reactivity and interaction with biological systems. It may be used in pharmaceutical applications or as an intermediate in organic synthesis. As with many amino acids and their derivatives, it may also exhibit specific biological activities, making it of interest in biochemical research. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₆H₁₃NO₂·ClH

InChI: InChI=1S/C6H13NO2.ClH/c1-5(4-7)2-3-6(8)9;/h5H,2-4,7H2,1H3,(H,8,9);1H

InChI key: InChIKey=FQRCLOMRTAUBSX-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)(CN)C.Cl

Synonyms:

• Pentanoic acid, 5-amino-4-methyl-, hydrochloride (1:1)

5-Amino-4-methylpentanoic acid hydrochloride

CAS: 1423024-55-8

Versatile small molecule scaffold

Formula: C₆H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 167.63 g/mol

Ref: 3D-YGC02455