CAS 1423024-60-5

Tryptophan, 4-bromo-, methyl ester, hydrochloride (1:1)

Description:

Tryptophan, 4-bromo-, methyl ester, hydrochloride (1:1) is a chemical compound derived from the amino acid tryptophan, modified by the addition of a bromine atom at the 4-position and esterification with methanol. This compound exists as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various biochemical applications. It typically appears as a white to off-white crystalline powder. The presence of the bromine substituent can influence the compound's biological activity and reactivity, potentially affecting its interactions in metabolic pathways. As a derivative of tryptophan, it may play a role in the synthesis of neurotransmitters and other biologically significant molecules. The compound is often used in research settings, particularly in studies related to amino acid metabolism, pharmacology, and the development of pharmaceuticals. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₂H₁₃BrN₂O₂·ClH

InChI: InChI=1S/C12H13BrN2O2.ClH/c1-17-12(16)9(14)5-7-6-15-10-4-2-3-8(13)11(7)10;/h2-4,6,9,15H,5,14H2,1H3;1H

InChI key: InChIKey=NQGHSJLHYRUBGS-UHFFFAOYSA-N

SMILES: C(C(C(OC)=O)N)C=1C=2C(NC1)=CC=CC2Br.Cl

Synonyms:

• Tryptophan, 4-bromo-, methyl ester, hydrochloride (1:1)

Methyl 2-amino-3-(4-bromo-1H-indol-3-yl)propanoate hydrochloride

CAS: 1423024-60-5

Versatile small molecule scaffold

Formula: C₁₂H₁₄BrClN₂O₂

Purity: Min. 95%

Molecular weight: 333.61 g/mol

Ref: 3D-YGC02460