CAS 1423024-79-6

Cyclopropaneacetic acid, α-(dimethylamino)-, hydrochloride (1:1)

Description:

Cyclopropaneacetic acid, α-(dimethylamino)-, hydrochloride (1:1) is a chemical compound characterized by its unique cyclopropane structure, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the dimethylamino group enhances its basicity and may influence its pharmacological properties, making it of interest in drug development. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various formulations. The compound's molecular structure suggests potential interactions with biological systems, particularly in the context of neurotransmitter modulation or as a precursor in synthetic pathways. Its CAS number, 1423024-79-6, allows for precise identification in chemical databases. Safety and handling considerations are essential, as with many organic compounds, and appropriate precautions should be taken to ensure safe laboratory practices. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential implications in therapeutic applications.

Formula: C₇H₁₃NO₂·ClH

InChI: InChI=1S/C7H13NO2.ClH/c1-8(2)6(7(9)10)5-3-4-5;/h5-6H,3-4H2,1-2H3,(H,9,10);1H

InChI key: InChIKey=GVUWSWNZDKAPTD-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N(C)C)C1CC1.Cl

Synonyms:

• 2-Cyclopropyl-2-(dimethylamino)acetic acid hydrochloride
• Cyclopropaneacetic acid, α-(dimethylamino)-, hydrochloride (1:1)

2-Cyclopropyl-2-(dimethylamino)acetic acid hydrochloride

CAS: 1423024-79-6

Versatile small molecule scaffold

Formula: C₇H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 179.64 g/mol

Ref: 3D-YGC02479