CAS 1423024-86-5

2-Pyrimidinemethanamine, α-cyclopropyl-4-methyl-, hydrochloride (1:2)

Description:

2-Pyrimidinemethanamine, α-cyclopropyl-4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. This compound features a cyclopropyl group and a methyl group attached to the alpha position of the pyrimidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine functional group suggests potential basicity and reactivity, making it a candidate for further chemical modifications or interactions. Its specific stereochemistry and substituent positions can influence its biological activity, making it of interest in medicinal chemistry. Overall, this compound's structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways or receptors.

Formula: C₉H₁₃N₃·2ClH

InChI: InChI=1S/C9H13N3.2ClH/c1-6-4-5-11-9(12-6)8(10)7-2-3-7;;/h4-5,7-8H,2-3,10H2,1H3;2*1H

InChI key: InChIKey=FMBYSAKUZONUJW-UHFFFAOYSA-N

SMILES: C(N)(C1CC1)C=2N=C(C)C=CN2.Cl

Synonyms:

• 2-Pyrimidinemethanamine, α-cyclopropyl-4-methyl-, hydrochloride (1:2)

Cyclopropyl(4-methylpyrimidin-2-yl)methanamine dihydrochloride

CAS: 1423024-86-5

Versatile small molecule scaffold

Formula: C₉H₁₅Cl₂N₃

Purity: Min. 95%

Molecular weight: 236.14 g/mol

Ref: 3D-YGC02486