CAS 1423025-03-9

1-Methylethyl 1,2-dihydro-2-oxo-4-pyridinecarboxylate

Description:

1-Methylethyl 1,2-dihydro-2-oxo-4-pyridinecarboxylate, identified by its CAS number 1423025-03-9, is a chemical compound that belongs to the class of pyridine derivatives. This substance typically exhibits characteristics common to esters and pyridine-based compounds, including a polar structure due to the presence of the carboxylate group, which can influence its solubility in polar solvents. The compound may display moderate to high reactivity, particularly in nucleophilic substitution reactions, owing to the electrophilic nature of the carbonyl group. Its molecular structure suggests potential applications in organic synthesis, possibly as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of the pyridine ring may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed information regarding its physical properties, such as boiling point, melting point, and specific reactivity, would require empirical data or literature references for precise characterization.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-6(2)13-9(12)7-3-4-10-8(11)5-7/h3-6H,1-2H3,(H,10,11)

InChI key: InChIKey=ABUWUNCCHYQIFZ-UHFFFAOYSA-N

SMILES: C(OC(C)C)(=O)C1=CC(=O)NC=C1

Synonyms:

• 4-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-, 1-methylethyl ester
• 1-Methylethyl 1,2-dihydro-2-oxo-4-pyridinecarboxylate

Propan-2-yl 2-hydroxypyridine-4-carboxylate

CAS: 1423025-03-9

Versatile small molecule scaffold

Formula: C₉H₁₁NO₃

Purity: Min. 95%

Molecular weight: 181.19 g/mol

Ref: 3D-YGC02503