CAS 1423025-10-8

2-Pyrrolidinecarboxamide, N-[(2-methylphenyl)methyl]-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-[(2-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a carboxamide functional group. The presence of the 2-methylphenyl group indicates that it has an aromatic component, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit properties such as being a potential ligand for biological targets, and its amide functionality suggests it could participate in hydrogen bonding, influencing its interactions in biological systems. The molecular weight and specific physical properties, such as melting point and solubility, would depend on the precise arrangement of atoms and the presence of the hydrochloride moiety. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmacology, although specific applications would require further investigation into its biological effects and mechanisms of action.

Formula: C₁₃H₁₈N₂O·ClH

InChI: InChI=1S/C13H18N2O.ClH/c1-10-5-2-3-6-11(10)9-15-13(16)12-7-4-8-14-12;/h2-3,5-6,12,14H,4,7-9H2,1H3,(H,15,16);1H

InChI key: InChIKey=PXQGHHAOSFXDFZ-UHFFFAOYSA-N

SMILES: C(NC(=O)C1CCCN1)C2=C(C)C=CC=C2.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-[(2-methylphenyl)methyl]-, hydrochloride (1:1)

N-[(2-Methylphenyl)methyl]pyrrolidine-2-carboxamide hydrochloride

CAS: 1423025-10-8

Versatile small molecule scaffold

Formula: C₁₃H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 254.75 g/mol

Ref: 3D-YGC02510