CAS 1423025-11-9

2-Quinolinecarboxylic acid, 4-amino-, methyl ester, hydrochloride (1:1)

Description:

2-Quinolinecarboxylic acid, 4-amino-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. The presence of a carboxylic acid group and an amino group indicates that it has both acidic and basic properties, making it a zwitterionic compound in certain conditions. The methyl ester form suggests that the carboxylic acid is esterified, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in drug synthesis. Its specific interactions and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and related fields. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₀N₂O₂·ClH

InChI: InChI=1S/C11H10N2O2.ClH/c1-15-11(14)10-6-8(12)7-4-2-3-5-9(7)13-10;/h2-6H,1H3,(H2,12,13);1H

InChI key: InChIKey=JCWBQKAKAUZMBV-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(C(OC)=O)C1)C=CC=C2.Cl

Synonyms:

• 2-Quinolinecarboxylic acid, 4-amino-, methyl ester, hydrochloride (1:1)

Methyl 4-aminoquinoline-2-carboxylate hydrochloride

CAS: 1423025-11-9

Versatile small molecule scaffold

Formula: C₁₁H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 238.7 g/mol

Ref: 3D-YGC02511