CAS 1423025-49-3

1-Hexanamine, 4-ethyl-3-methoxy-, hydrochloride (1:1)

Description:

1-Hexanamine, 4-ethyl-3-methoxy-, hydrochloride (1:1) is an organic compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of a hexanamine backbone indicates a six-carbon chain with an amine group, while the ethyl and methoxy substituents introduce additional functional diversity, influencing its solubility and interaction with other molecules. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and chemical synthesis. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, this compound represents a versatile building block in organic chemistry with potential applications in medicinal chemistry and material science.

Formula: C₉H₂₁NO·ClH

InChI: InChI=1S/C9H21NO.ClH/c1-4-8(5-2)9(11-3)6-7-10;/h8-9H,4-7,10H2,1-3H3;1H

InChI key: InChIKey=BFWBQSURRYKHAG-UHFFFAOYSA-N

SMILES: C(C(CC)CC)(CCN)OC.Cl

Synonyms:

• 1-Hexanamine, 4-ethyl-3-methoxy-, hydrochloride (1:1)

4-Ethyl-3-methoxyhexan-1-amine hydrochloride

CAS: 1423025-49-3

Versatile small molecule scaffold

Formula: C₉H₂₂ClNO

Purity: Min. 95%

Molecular weight: 195.73 g/mol

Ref: 3D-YGC02549