CAS 1423025-57-3

Benzenemethanamine, N-cyclohexyl-2-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-cyclohexyl-2-fluoro-, hydrochloride (1:1), with the CAS number 1423025-57-3, is a chemical compound characterized by its amine functional group and a cyclohexyl substituent. This compound features a benzene ring attached to a methanamine structure, with a fluorine atom positioned at the second carbon of the benzene ring. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which typically enhances the solubility of the compound in water and other polar solvents. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the fluorine atom may impart unique electronic properties, potentially influencing its reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research or organic synthesis due to its structural features, which can affect its biological activity and potential applications. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions.

Formula: C₁₃H₁₈FN·ClH

InChI: InChI=1S/C13H18FN.ClH/c14-13-9-5-4-6-11(13)10-15-12-7-2-1-3-8-12;/h4-6,9,12,15H,1-3,7-8,10H2;1H

InChI key: InChIKey=BOXSGDGTTRJRSO-UHFFFAOYSA-N

SMILES: C(NC1CCCCC1)C2=C(F)C=CC=C2.Cl

Synonyms:

• Benzenemethanamine, N-cyclohexyl-2-fluoro-, hydrochloride (1:1)

N-[(2-Fluorophenyl)methyl]cyclohexanamine hydrochloride

CAS: 1423025-57-3

Versatile small molecule scaffold

Formula: C₁₃H₁₉ClFN

Purity: Min. 95%

Molecular weight: 243.75 g/mol

Ref: 3D-YGC02557