CAS 1423025-58-4

1-(2-Ethoxyethyl)cyclopropanemethanamine

Description:

1-(2-Ethoxyethyl)cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an ethoxyethyl group. This compound features a primary amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and formation of amides. The presence of the ethoxyethyl group enhances its solubility in organic solvents and may influence its biological activity. The cyclopropane moiety contributes to the compound's rigidity and may affect its conformational properties, potentially impacting its reactivity and interaction with biological targets. Additionally, the compound's molecular weight and specific functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As with many amines, it may exhibit basicity and can form salts with acids. Safety and handling precautions should be observed, as amines can be irritants and may have specific toxicity profiles. Overall, 1-(2-Ethoxyethyl)cyclopropanemethanamine represents a versatile structure with potential implications in various chemical and pharmaceutical contexts.

Formula: C₈H₁₇NO

InChI: InChI=1S/C8H17NO/c1-2-10-6-5-8(7-9)3-4-8/h2-7,9H2,1H3

InChI key: InChIKey=XKUBJBFEFYEFTP-UHFFFAOYSA-N

SMILES: C(COCC)C1(CN)CC1

Synonyms:

• Cyclopropanemethanamine, 1-(2-ethoxyethyl)-
• 1-(2-Ethoxyethyl)cyclopropanemethanamine

[1-(2-Ethoxyethyl)cyclopropyl]methanamine

CAS: 1423025-58-4

Versatile small molecule scaffold

Formula: C₈H₁₇NO

Purity: Min. 95%

Molecular weight: 143.23 g/mol

Ref: 3D-YGC02558