CAS 1423025-82-4

2-(4-Nitro-1H-pyrazol-1-yl)quinoxaline

Description:

2-(4-Nitro-1H-pyrazol-1-yl)quinoxaline is a chemical compound characterized by its unique structure, which combines a quinoxaline moiety with a 4-nitro-1H-pyrazole substituent. This compound typically exhibits properties associated with both heterocyclic compounds and nitro groups, such as potential biological activity and reactivity. The presence of the nitro group may impart additional polar characteristics, influencing its solubility and interaction with biological systems. Quinoxaline derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and reductions, due to the presence of both electron-withdrawing and electron-donating groups. Its specific applications and behavior in biological systems would depend on further empirical studies, including its stability, reactivity under different conditions, and potential therapeutic effects. Overall, 2-(4-Nitro-1H-pyrazol-1-yl)quinoxaline represents a class of compounds of interest in medicinal chemistry and material science.

Formula: C₁₁H₇N₅O₂

InChI: InChI=1S/C11H7N5O2/c17-16(18)8-5-13-15(7-8)11-6-12-9-3-1-2-4-10(9)14-11/h1-7H

InChI key: InChIKey=HAENXKZHCAHQHL-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(C2=NC3=C(N=C2)C=CC=C3)N=C1

Synonyms:

• Quinoxaline, 2-(4-nitro-1H-pyrazol-1-yl)-
• 2-(4-Nitro-1H-pyrazol-1-yl)quinoxaline

2-(4-Nitro-1H-pyrazol-1-yl)quinoxaline

CAS: 1423025-82-4

Versatile small molecule scaffold

Formula: C₁₁H₇N₅O₂

Purity: Min. 95%

Molecular weight: 241.21 g/mol

Ref: 3D-YGC02582