CAS 1423025-90-4

Cyclohexanamine, 1-[3-(1,1-dimethylethyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

Description:

Cyclohexanamine, 1-[3-(1,1-dimethylethyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclohexanamine backbone and a substituent oxadiazole ring. The presence of the oxadiazole moiety, which contains nitrogen and oxygen, contributes to its potential biological activity and may influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. The compound's structure suggests it may exhibit properties such as basicity due to the amine group, and it may participate in hydrogen bonding due to the presence of the oxadiazole. Its specific applications and biological effects would depend on further studies, including pharmacological evaluations. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₂H₂₁N₃O·ClH

InChI: InChI=1S/C12H21N3O.ClH/c1-11(2,3)9-14-10(16-15-9)12(13)7-5-4-6-8-12;/h4-8,13H2,1-3H3;1H

InChI key: InChIKey=INOVYYSEIJUTJH-UHFFFAOYSA-N

SMILES: NC1(CCCCC1)C2=NC(C(C)(C)C)=NO2.Cl

Synonyms:

• Cyclohexanamine, 1-[3-(1,1-dimethylethyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

1-(3-tert-Butyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine hydrochloride

Controlled Product

CAS: 1423025-90-4

Versatile small molecule scaffold

Formula: C₁₂H₂₂ClN₃O

Purity: Min. 95%

Molecular weight: 259.77 g/mol

Ref: 3D-YGC02590