CAS 1423026-05-4

1H-Imidazole, 1-(4-bromobutyl)-2-methyl-, hydrobromide (1:1)

Description:

1H-Imidazole, 1-(4-bromobutyl)-2-methyl-, hydrobromide (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a 4-bromobutyl side chain and a methyl group at the 2-position of the imidazole ring, contributing to its unique properties. The hydrobromide form indicates that it is a salt formed with hydrobromic acid, enhancing its solubility in polar solvents, particularly water. The presence of the bromobutyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may exhibit biological activity, influenced by the imidazole moiety, which is known for its role in various biochemical processes. Additionally, the hydrobromide salt form can affect the compound's stability and reactivity. Overall, this substance is of interest in both synthetic and medicinal chemistry contexts, warranting further investigation into its properties and potential applications.

Formula: C₈H₁₃BrN₂·BrH

InChI: InChI=1S/C8H13BrN2.BrH/c1-8-10-5-7-11(8)6-3-2-4-9;/h5,7H,2-4,6H2,1H3;1H

InChI key: InChIKey=WNPGQHNRUDXYDI-UHFFFAOYSA-N

SMILES: C(CCCBr)N1C(C)=NC=C1.Br

Synonyms:

• 1H-Imidazole, 1-(4-bromobutyl)-2-methyl-, hydrobromide (1:1)

1-(4-Bromobutyl)-2-methyl-1H-imidazole hydrobromide

CAS: 1423026-05-4

Versatile small molecule scaffold

Formula: C₈H₁₄Br₂N₂

Purity: Min. 95%

Molecular weight: 298.02 g/mol

Ref: 3D-YGC02605