CAS 1423026-15-6

2-Pyrrolidineacetic acid, 1-(1-methylethyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidineacetic acid, 1-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which contributes to its cyclic amine properties. This substance is a hydrochloride salt, indicating that it is the hydrochloric acid salt of the base form of the compound, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the isopropyl group (1-(1-methylethyl)-) suggests that it may exhibit specific steric and electronic properties, influencing its biological activity and interaction with receptors or enzymes. As a carboxylic acid derivative, it may participate in acid-base reactions and form esters or amides under appropriate conditions. The compound's molecular structure likely imparts characteristics such as moderate polarity and potential for hydrogen bonding, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound may have relevance in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₉H₁₇NO₂·ClH

InChI: InChI=1S/C9H17NO2.ClH/c1-7(2)10-5-3-4-8(10)6-9(11)12;/h7-8H,3-6H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=MQMSWWIEYWNMAZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1N(C(C)C)CCC1.Cl

Synonyms:

• 2-Pyrrolidineacetic acid, 1-(1-methylethyl)-, hydrochloride (1:1)

2-[1-(Propan-2-yl)pyrrolidin-2-yl]acetic acid hydrochloride

CAS: 1423026-15-6

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 207.7 g/mol

Ref: 3D-YGC02615