CAS 1423026-63-4

7-[4-(Trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

7-[4-(Trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique molecular configuration. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. As a carboxylic acid, it possesses acidic properties, which may affect its solubility and stability in various solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 1423026-63-4, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in research and industry. Overall, this compound represents a significant interest in the field of organic chemistry and drug development.

Formula: C₁₄H₈F₃N₃O₂

InChI: InChI=1S/C14H8F3N3O2/c15-14(16,17)9-3-1-8(2-4-9)11-5-6-18-12-10(13(21)22)7-19-20(11)12/h1-7H,(H,21,22)

InChI key: InChIKey=GELXSWMAYFQGSJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C(=CC=N2)C3=CC=C(C(F)(F)F)C=C3)N=C1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-[4-(trifluoromethyl)phenyl]-
• 7-[4-(Trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

7-[4-(Trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 1423026-63-4

Versatile small molecule scaffold

Formula: C₁₄H₈F₃N₃O₂

Purity: Min. 95%

Molecular weight: 307.23 g/mol

Ref: 3D-YGC02663