CymitQuimica logo

CAS 1423026-73-6

:

5,6,7,8-Tetrahydro-2-methyl-1,2,4-triazolo[4,3-a]pyrazin-3(2H)-one

Description:
5,6,7,8-Tetrahydro-2-methyl-1,2,4-triazolo[4,3-a]pyrazin-3(2H)-one is a heterocyclic compound characterized by its complex ring structure, which includes both triazole and pyrazine moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The presence of a methyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 1423026-73-6, allows for precise identification in chemical databases. As with many heterocycles, it may exhibit a range of activities, including antimicrobial, anti-inflammatory, or other therapeutic effects, depending on its specific interactions within biological systems. Further studies would be necessary to elucidate its full range of properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C6H10N4O
InChI:InChI=1S/C6H10N4O/c1-9-6(11)10-3-2-7-4-5(10)8-9/h7H,2-4H2,1H3
InChI key:InChIKey=UXJQJZWSAVORIW-UHFFFAOYSA-N
SMILES:O=C1N2C(=NN1C)CNCC2
Synonyms:
  • 1,2,4-Triazolo[4,3-a]pyrazin-3(2H)-one, 5,6,7,8-tetrahydro-2-methyl-
  • 5,6,7,8-Tetrahydro-2-methyl-1,2,4-triazolo[4,3-a]pyrazin-3(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.