CAS 1423026-93-0

Guanidine, N-cyclopropyl-N-methyl-, hydrochloride (1:1)

Description:

Guanidine, N-cyclopropyl-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its guanidine structure, which features a central carbon atom bonded to three nitrogen atoms and a cyclopropyl group attached to one of the nitrogen atoms. This compound is typically encountered as a hydrochloride salt, indicating that it is in a protonated form, which enhances its solubility in water. The presence of the cyclopropyl group contributes to its unique steric and electronic properties, potentially influencing its reactivity and biological activity. Guanidine derivatives are often studied for their pharmacological applications, including their roles as intermediates in the synthesis of various pharmaceuticals. The compound may exhibit basic properties due to the guanidine moiety, and its hydrochloride form can be utilized in various chemical reactions and formulations. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₅H₁₁N₃·ClH

InChI: InChI=1S/C5H11N3.ClH/c1-8(5(6)7)4-2-3-4;/h4H,2-3H2,1H3,(H3,6,7);1H

InChI key: InChIKey=GAGOCJPBJGPSTM-UHFFFAOYSA-N

SMILES: N(C(=N)N)(C)C1CC1.Cl

Synonyms:

• 1-Cyclopropyl-1-methylguanidine hydrochloride
• Guanidine, N-cyclopropyl-N-methyl-, hydrochloride (1:1)

1-Cyclopropyl-1-methylguanidine hydrochloride

CAS: 1423026-93-0

Versatile small molecule scaffold

Formula: C₅H₁₂ClN₃

Purity: Min. 95%

Molecular weight: 149.62 g/mol

Ref: 3D-YGC02693