CAS 1423027-14-8

Benzenemethanamine, 2-[(1-piperidinylsulfonyl)methyl]-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-[(1-piperidinylsulfonyl)methyl]-, hydrochloride (1:1), commonly referred to as a piperidine derivative, is a chemical compound characterized by its amine and sulfonyl functional groups. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The piperidine ring contributes to its pharmacological properties, often making it a subject of interest in medicinal chemistry for potential therapeutic applications. The sulfonyl group can enhance the compound's reactivity and interaction with biological targets. As with many amines, it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Safety data should be consulted for handling, as compounds with amine functionalities can pose risks such as irritation or toxicity. Overall, this compound's unique structure and functional groups make it a valuable candidate for research in drug development and related fields.

Formula: C₁₃H₂₀N₂O₂S·ClH

InChI: InChI=1S/C13H20N2O2S.ClH/c14-10-12-6-2-3-7-13(12)11-18(16,17)15-8-4-1-5-9-15;/h2-3,6-7H,1,4-5,8-11,14H2;1H

InChI key: InChIKey=AFPUQGAHMGGHTE-UHFFFAOYSA-N

SMILES: C(S(=O)(=O)N1CCCCC1)C2=C(CN)C=CC=C2.Cl

Synonyms:

• Benzenemethanamine, 2-[(1-piperidinylsulfonyl)methyl]-, hydrochloride (1:1)

{2-[(Piperidine-1-sulfonyl)methyl]phenyl}methanamine hydrochloride

CAS: 1423027-14-8

Versatile small molecule scaffold

Formula: C₁₃H₂₁ClN₂O₂S

Purity: Min. 95%

Molecular weight: 304.84 g/mol

Ref: 3D-YGC02714