CAS 1423027-63-7

3-Phenylisoxazolo[5,4-b]pyridine-5-sulfonyl chloride

Description:

3-Phenylisoxazolo[5,4-b]pyridine-5-sulfonyl chloride is a chemical compound characterized by its unique structural features, which include a fused isoxazole and pyridine ring system, along with a sulfonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and applications in organic synthesis. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the phenyl group enhances its lipophilicity, which can influence its biological activity and solubility in organic solvents. The compound's specific reactivity and applications may vary based on the functional groups present and the overall molecular structure, making it a subject of interest in medicinal chemistry and material science. As with many sulfonyl chlorides, it should be handled with care due to its potential to release hydrochloric acid upon reaction with water or alcohols.

Formula: C₁₂H₇ClN₂O₃S

InChI: InChI=1S/C12H7ClN2O3S/c13-19(16,17)9-6-10-11(8-4-2-1-3-5-8)15-18-12(10)14-7-9/h1-7H

InChI key: InChIKey=RMENGPPTHWFIPN-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C2C(=NOC2=NC1)C3=CC=CC=C3

Synonyms:

• Isoxazolo[5,4-b]pyridine-5-sulfonyl chloride, 3-phenyl-
• 3-Phenylisoxazolo[5,4-b]pyridine-5-sulfonyl chloride

3-Phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride

CAS: 1423027-63-7

Versatile small molecule scaffold

Formula: C₁₂H₇ClN₂O₃S

Purity: Min. 95%

Molecular weight: 294.71 g/mol

Ref: 3D-YGC02763