CAS 1423028-15-2

2-Pyrrolidinone, 3-amino-1-cyclopropyl-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 3-amino-1-cyclopropyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. The presence of an amino group at the 3-position and a cyclopropyl substituent contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the realm of central nervous system agents. Its molecular interactions can be influenced by the cyclopropyl group, which may affect the compound's pharmacokinetics and pharmacodynamics. Safety and handling considerations are essential, as with any chemical substance, and appropriate measures should be taken to ensure compliance with regulatory standards. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.

Formula: C₇H₁₂N₂O·ClH

InChI: InChI=1S/C7H12N2O.ClH/c8-6-3-4-9(7(6)10)5-1-2-5;/h5-6H,1-4,8H2;1H

InChI key: InChIKey=YHCYUHXAJJDFSW-UHFFFAOYSA-N

SMILES: O=C1N(CCC1N)C2CC2.Cl

Synonyms:

• 2-Pyrrolidinone, 3-amino-1-cyclopropyl-, hydrochloride (1:1)

3-Amino-1-cyclopropylpyrrolidin-2-one hydrochloride

CAS: 1423028-15-2

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 176.64 g/mol

Ref: 3D-YGC02815