CAS 1423028-16-3

1-Propanone, 3-amino-1-(4-morpholinyl)-3-phenyl-, hydrochloride (1:1)

Description:

1-Propanone, 3-amino-1-(4-morpholinyl)-3-phenyl-, hydrochloride (1:1), with CAS number 1423028-16-3, is a chemical compound characterized by its structural features that include a propanone backbone, an amino group, and a morpholine ring. This compound typically exhibits properties associated with both ketones and amines, such as potential reactivity in nucleophilic substitution reactions due to the presence of the amino group. The hydrochloride form indicates that it is a salt, which often enhances its solubility in water and stability compared to its free base form. The morpholine moiety contributes to its pharmacological properties, potentially influencing its interaction with biological targets. As a hydrochloride salt, it may also exhibit different physical properties, such as melting point and solubility, compared to the base compound. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific biological activities.

Formula: C₁₃H₁₈N₂O₂·ClH

InChI: InChI=1S/C13H18N2O2.ClH/c14-12(11-4-2-1-3-5-11)10-13(16)15-6-8-17-9-7-15;/h1-5,12H,6-10,14H2;1H

InChI key: InChIKey=SQRCLAHLWAMXFV-UHFFFAOYSA-N

SMILES: C(CC(=O)N1CCOCC1)(N)C2=CC=CC=C2.Cl

Synonyms:

• 1-Propanone, 3-amino-1-(4-morpholinyl)-3-phenyl-, hydrochloride (1:1)

3-Amino-1-(morpholin-4-yl)-3-phenylpropan-1-one hydrochloride

CAS: 1423028-16-3

Versatile small molecule scaffold

Formula: C₁₃H₁₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 270.75 g/mol

Ref: 3D-YGC02816