CAS 1423028-48-1

Piperidine, 4-(1H-1,2,3-triazol-1-yl)-, hydrochloride (1:2)

Description:

Piperidine, 4-(1H-1,2,3-triazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 1H-1,2,3-triazole moiety introduces additional nitrogen atoms and contributes to the compound's potential biological activity. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and drug development. The triazole group is known for its role in pharmaceuticals, often exhibiting antifungal and antimicrobial properties. The specific arrangement of functional groups in this compound may influence its pharmacokinetic and pharmacodynamic profiles, making it a subject of interest in research focused on developing new therapeutic agents. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other interactions, which can be critical for its biological function. Safety and handling precautions should be observed due to its potential biological activity.

Formula: C₇H₁₂N₄·2ClH

InChI: InChI=1S/C7H12N4.2ClH/c1-3-8-4-2-7(1)11-6-5-9-10-11;;/h5-8H,1-4H2;2*1H

InChI key: InChIKey=CHMSJTQAAJNALK-UHFFFAOYSA-N

SMILES: N1(C=CN=N1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(1H-1,2,3-triazol-1-yl)-, hydrochloride (1:2)

4-(1H-1,2,3-Triazol-1-yl)piperidine dihydrochloride

CAS: 1423028-48-1

Versatile small molecule scaffold

Formula: C₇H₁₄Cl₂N₄

Purity: Min. 95%

Molecular weight: 225.12 g/mol

Ref: 3D-YGC02848