CAS 1423029-11-1

Cycloheptanamine, 1-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

Description:

Cycloheptanamine, 1-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and an oxadiazole moiety. The presence of the cyclopentylmethyl group contributes to its hydrophobic characteristics, while the oxadiazole ring may impart specific biological activities or interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, and it may participate in hydrogen bonding due to the amine and oxadiazole functionalities. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₅H₂₅N₃O·ClH

InChI: InChI=1S/C15H25N3O.ClH/c16-15(9-5-1-2-6-10-15)14-17-13(19-18-14)11-12-7-3-4-8-12;/h12H,1-11,16H2;1H

InChI key: InChIKey=JXNPTMFJSZDNFU-UHFFFAOYSA-N

SMILES: NC1(CCCCCC1)C=2N=C(CC3CCCC3)ON2.Cl

Synonyms:

• Cycloheptanamine, 1-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

1-[5-(Cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]cycloheptan-1-amine hydrochloride

CAS: 1423029-11-1

Versatile small molecule scaffold

Formula: C₁₅H₂₆ClN₃O

Purity: Min. 95%

Molecular weight: 299.84 g/mol

Ref: 3D-YGC02911