CAS 1423029-18-8

3-Pyrrolidinol, 5-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1)

Description:

3-Pyrrolidinol, 5-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a trifluoromethyl group on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting pharmacological properties due to the combination of the pyrrolidine and trifluoromethyl functionalities, making it a candidate for research in medicinal chemistry. Its CAS number, 1423029-18-8, allows for precise identification in chemical databases. Safety and handling considerations should be observed, as with many organic compounds, particularly those with halogen substituents, which can pose environmental and health risks. Overall, this compound's unique structure suggests potential utility in various chemical and biological applications.

Formula: C₁₁H₁₂F₃NO·ClH

InChI: InChI=1S/C11H12F3NO.ClH/c12-11(13,14)8-3-1-7(2-4-8)10-5-9(16)6-15-10;/h1-4,9-10,15-16H,5-6H2;1H

InChI key: InChIKey=VBICUPWBVAIBQA-UHFFFAOYSA-N

SMILES: OC1CC(C2=CC=C(C(F)(F)F)C=C2)NC1.Cl

Synonyms:

• 3-Pyrrolidinol, 5-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1)

5-[4-(Trifluoromethyl)phenyl]pyrrolidin-3-ol hydrochloride

CAS: 1423029-18-8

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClF₃NO

Purity: Min. 95%

Molecular weight: 267.67 g/mol

Ref: 3D-YGC02918