CAS 1423029-27-9

4-Thiazoleethanamine, 2-(4-fluorophenyl)-, hydrochloride (1:2)

Description:

4-Thiazoleethanamine, 2-(4-fluorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole and phenyl functional groups, which contribute to its potential biological activity. The presence of the 4-fluorophenyl moiety suggests that it may exhibit unique electronic properties due to the fluorine substituent, potentially influencing its reactivity and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The thiazole ring is known for its role in various biological activities, including antimicrobial and anticancer properties. This compound may be of interest in medicinal chemistry for the development of new therapeutic agents. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in drug development.

Formula: C₁₁H₁₁FN₂S·2ClH

InChI: InChI=1S/C11H11FN2S.2ClH/c12-9-3-1-8(2-4-9)11-14-10(5-6-13)7-15-11;;/h1-4,7H,5-6,13H2;2*1H

InChI key: InChIKey=MLEIXWAFVNXLSJ-UHFFFAOYSA-N

SMILES: C(CN)C=1N=C(SC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 4-Thiazoleethanamine, 2-(4-fluorophenyl)-, hydrochloride (1:2)

2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethan-1-amine dihydrochloride

CAS: 1423029-27-9

Formula: C₁₁H₁₃Cl₂FN₂S

Purity: 95.0%

Molecular weight: 295.2

Ref: 10-F541894

2-[2-(4-Fluorophenyl)-1,3-thiazol-4-yl]ethan-1-amine dihydrochloride

CAS: 1423029-27-9

Versatile small molecule scaffold

Formula: C₁₁H₁₃Cl₂FN₂S

Purity: Min. 95%

Molecular weight: 295.2 g/mol

Ref: 3D-YGC02927