CAS 1423029-42-8

Benzenebutanenitrile, γ-amino-, hydrochloride (1:1)

Description:

Benzenebutanenitrile, γ-amino-, hydrochloride (1:1), with the CAS number 1423029-42-8, is a chemical compound characterized by its structural features that include a benzene ring and a butanenitrile moiety, along with an amino group. This compound exists as a hydrochloride salt, which typically enhances its solubility in water and may influence its pharmacological properties. The presence of the amino group suggests potential basicity, allowing it to form salts with acids, while the nitrile group can participate in various chemical reactions, including nucleophilic additions. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its hydrochloride form is often utilized in formulations to improve stability and bioavailability. As with many organic compounds, the specific physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage, as with any chemical compound.

Formula: C₁₀H₁₂N₂·ClH

InChI: InChI=1S/C10H12N2.ClH/c11-8-4-7-10(12)9-5-2-1-3-6-9;/h1-3,5-6,10H,4,7,12H2;1H

InChI key: InChIKey=GDSIKCDGBWGOLA-UHFFFAOYSA-N

SMILES: C(CCC#N)(N)C1=CC=CC=C1.Cl

Synonyms:

• Benzenebutanenitrile, γ-amino-, hydrochloride (1:1)

4-Amino-4-phenylbutanenitrile hydrochloride

CAS: 1423029-42-8

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClN₂

Purity: Min. 95%

Molecular weight: 196.67 g/mol

Ref: 3D-YGC02942