CymitQuimica logo

CAS 1423029-60-0

:

Benzenamine, 2,6-dichloro-N-methyl-, hydrochloride (1:1)

Description:
Benzenamine, 2,6-dichloro-N-methyl-, hydrochloride (1:1), also known as 2,6-dichloro-N-methyl-aniline hydrochloride, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with two chlorine atoms at the 2 and 6 positions and a methyl group attached to the nitrogen atom of the amine functional group. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. This compound typically appears as a crystalline solid and is used in various chemical applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Its properties include moderate toxicity, necessitating careful handling and storage. The presence of chlorine substituents can influence its reactivity and stability, making it a subject of interest in both synthetic and environmental chemistry. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions.
Formula:C7H7Cl2N·ClH
InChI:InChI=1S/C7H7Cl2N.ClH/c1-10-7-5(8)3-2-4-6(7)9;/h2-4,10H,1H3;1H
InChI key:InChIKey=IPYMEACBPVDBCS-UHFFFAOYSA-N
SMILES:N(C)C1=C(Cl)C=CC=C1Cl.Cl
Synonyms:
  • Benzenamine, 2,6-dichloro-N-methyl-, hydrochloride (1:1)
Found 1 products.