CAS 1423029-71-3

4-[(2-Cyano-4-pyridinyl)oxy]benzeneacetic acid

Description:

4-[(2-Cyano-4-pyridinyl)oxy]benzeneacetic acid, identified by its CAS number 1423029-71-3, is a chemical compound characterized by its unique structure that includes a benzeneacetic acid moiety linked to a pyridine derivative via an ether bond. This compound features a cyano group attached to the pyridine ring, which can influence its reactivity and solubility. The presence of both the carboxylic acid and cyano functional groups suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may impart specific pharmacological properties, potentially affecting its efficacy and safety profile in biological systems. Additionally, the compound's solubility and stability can be influenced by pH and solvent conditions, which are critical factors in its application in research and development. Overall, this compound's characteristics make it a candidate for further investigation in various chemical and pharmaceutical contexts.

Formula: C₁₄H₁₀N₂O₃

InChI: InChI=1S/C14H10N2O3/c15-9-11-8-13(5-6-16-11)19-12-3-1-10(2-4-12)7-14(17)18/h1-6,8H,7H2,(H,17,18)

InChI key: InChIKey=QFEYWPXBMRNHBI-UHFFFAOYSA-N

SMILES: O(C=1C=C(C#N)N=CC1)C2=CC=C(CC(O)=O)C=C2

Synonyms:

• 4-[(2-Cyano-4-pyridinyl)oxy]benzeneacetic acid
• Benzeneacetic acid, 4-[(2-cyano-4-pyridinyl)oxy]-

2-{4-[(2-Cyanopyridin-4-yl)oxy]phenyl}acetic acid

CAS: 1423029-71-3

Versatile small molecule scaffold

Formula: C₁₄H₁₀N₂O₃

Purity: Min. 95%

Molecular weight: 254.24 g/mol

Ref: 3D-YGC02971