CAS 1423029-72-4

2-Chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]acetamide

Description:

2-Chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro group, a methyl group, and an acetamide moiety, which contribute to its reactivity and potential applications in various fields, including medicinal chemistry. The presence of the 3-nitrophenyl group indicates that the compound may exhibit interesting electronic properties and biological activity, potentially serving as a lead compound in drug development. The molecular structure suggests that it may participate in hydrogen bonding due to the amide functionality, influencing its solubility and interaction with biological targets. Additionally, the chlorine atom may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, the characteristics of this compound make it a subject of interest for further research, particularly in the context of its synthesis, reactivity, and potential therapeutic applications.

Formula: C₁₁H₁₃ClN₂O₃

InChI: InChI=1S/C11H13ClN2O3/c1-8(13(2)11(15)7-12)9-4-3-5-10(6-9)14(16)17/h3-6,8H,7H2,1-2H3

InChI key: InChIKey=YJNXCBZPMBAIPU-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)C)(C)C1=CC(N(=O)=O)=CC=C1

Synonyms:

• Acetamide, 2-chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]-
• 2-Chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]acetamide

2-Chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]acetamide

CAS: 1423029-72-4

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClN₂O₃

Purity: Min. 95%

Molecular weight: 256.68 g/mol

Ref: 3D-YGC02972