CAS 1423029-84-8

1-Piperidinecarboxamide, 4-[(methylamino)methyl]-N-phenyl-, hydrochloride (1:1)

Description:

1-Piperidinecarboxamide, 4-[(methylamino)methyl]-N-phenyl-, hydrochloride (1:1), identified by CAS number 1423029-84-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N), which contributes to its potential as a pharmacological agent. The presence of a phenyl group suggests aromatic characteristics, which can influence the compound's reactivity and interaction with biological systems. The methylamino group indicates that there is a methyl group attached to an amino group, enhancing the compound's basicity and potential for forming hydrogen bonds. As a hydrochloride salt, it is likely to be more soluble in water, which is advantageous for various applications, including pharmaceutical formulations. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₄H₂₁N₃O·ClH

InChI: InChI=1S/C14H21N3O.ClH/c1-15-11-12-7-9-17(10-8-12)14(18)16-13-5-3-2-4-6-13;/h2-6,12,15H,7-11H2,1H3,(H,16,18);1H

InChI key: InChIKey=PAQSWQYLIZSERM-UHFFFAOYSA-N

SMILES: C(NC1=CC=CC=C1)(=O)N2CCC(CNC)CC2.Cl

Synonyms:

• 1-Piperidinecarboxamide, 4-[(methylamino)methyl]-N-phenyl-, hydrochloride (1:1)

4-[(Methylamino)methyl]-N-phenylpiperidine-1-carboxamide hydrochloride

CAS: 1423029-84-8

Versatile small molecule scaffold

Formula: C₁₄H₂₂ClN₃O

Purity: Min. 95%

Molecular weight: 283.8 g/mol

Ref: 3D-YGC02984