CAS 1423030-98-1

3-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride

Description:

3-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrazolo-pyrimidine core with a bromine substituent and a sulfonyl chloride functional group. This compound typically exhibits properties associated with both heterocyclic compounds and sulfonyl chlorides, such as reactivity towards nucleophiles due to the presence of the sulfonyl chloride group, which can participate in various substitution reactions. The bromine atom can also serve as a site for further functionalization. In terms of solubility, compounds of this nature are often soluble in polar organic solvents, making them useful in synthetic chemistry. The presence of the sulfonyl chloride group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can facilitate the introduction of diverse functional groups. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, 3-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride is a versatile intermediate in organic synthesis.

Formula: C₇H₅BrClN₃O₂S

InChI: InChI=1S/C7H5BrClN3O2S/c1-4-6(8)7-10-2-5(15(9,13)14)3-12(7)11-4/h2-3H,1H3

InChI key: InChIKey=HZPQWVLVWUMKGN-UHFFFAOYSA-N

SMILES: BrC1=C2N(C=C(S(Cl)(=O)=O)C=N2)N=C1C

Synonyms:

• 3-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride
• Pyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride, 3-bromo-2-methyl-