CAS 1423031-04-2

Ethyl 3-(methoxymethyl)-1,2,4-oxadiazole-5-acetate

Description:

Ethyl 3-(methoxymethyl)-1,2,4-oxadiazole-5-acetate is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. This compound features an ethyl ester functional group, enhancing its solubility in organic solvents and possibly influencing its reactivity. The methoxymethyl substituent adds to its complexity, potentially affecting its interaction with biological targets. The oxadiazole moiety is known for its presence in various pharmaceuticals and agrochemicals, often associated with antimicrobial and antifungal properties. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest in synthetic organic chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. Overall, this compound represents a class of heterocyclic compounds that are valuable in medicinal chemistry and materials science.

Formula: C₈H₁₂N₂O₄

InChI: InChI=1S/C8H12N2O4/c1-3-13-8(11)4-7-9-6(5-12-2)10-14-7/h3-5H2,1-2H3

InChI key: InChIKey=UJASMWQHBCFWBP-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1=NC(COC)=NO1

Synonyms:

• Ethyl 3-(methoxymethyl)-1,2,4-oxadiazole-5-acetate
• 1,2,4-Oxadiazole-5-acetic acid, 3-(methoxymethyl)-, ethyl ester

Ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate

CAS: 1423031-04-2

Versatile small molecule scaffold

Formula: C₈H₁₂N₂O₄

Purity: Min. 95%

Molecular weight: 200.19 g/mol

Ref: 3D-YGC03104