CAS 1423031-10-0

6-Bromo-1,4,8-trioxaspiro[4.5]decane

Description:

6-Bromo-1,4,8-trioxaspiro[4.5]decane is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring a central spiro carbon atom. The presence of three oxygen atoms in the form of trioxaspiro indicates that the compound contains ether linkages, contributing to its stability and potential reactivity. The bromine substituent at the 6-position introduces halogen functionality, which can influence the compound's reactivity and solubility in various solvents. This compound may exhibit interesting properties such as potential biological activity, making it of interest in medicinal chemistry and materials science. Its structural features suggest that it could participate in various chemical reactions, including nucleophilic substitutions or cycloadditions, depending on the reaction conditions. Additionally, the spiro structure may impart unique steric and electronic properties, which could be leveraged in the design of novel compounds for specific applications. Overall, 6-Bromo-1,4,8-trioxaspiro[4.5]decane represents a fascinating subject for further research in organic synthesis and functional materials.

Formula: C₇H₁₁BrO₃

InChI: InChI=1S/C7H11BrO3/c8-6-5-9-2-1-7(6)10-3-4-11-7/h6H,1-5H2

InChI key: InChIKey=YVCXYXUDSUQYNF-UHFFFAOYSA-N

SMILES: BrC1C2(CCOC1)OCCO2

Synonyms:

• 1,4,8-Trioxaspiro[4.5]decane, 6-bromo-
• 6-Bromo-1,4,8-trioxaspiro[4.5]decane

6-Bromo-1,4,8-trioxaspiro[4.5]decane

CAS: 1423031-10-0

Versatile small molecule scaffold

Formula: C₇H₁₁BrO₃

Purity: Min. 95%

Molecular weight: 223.06 g/mol

Ref: 3D-YGC03110