CAS 1423031-11-1

4-Thiazoleethanamine, 2-(2-chlorophenyl)-, hydrochloride (1:2)

Description:

4-Thiazoleethanamine, 2-(2-chlorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole and chlorophenyl functional groups. The thiazole ring contributes to its heterocyclic nature, which can influence its biological activity and reactivity. The presence of the 2-chlorophenyl group suggests potential applications in medicinal chemistry, as chlorinated aromatic compounds often exhibit enhanced pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various formulations. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on its structure-activity relationship. The hydrochloride form also indicates that it can be used in a more stable and manageable form for laboratory and pharmaceutical applications. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with potential biological activity. Further research would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₁H₁₁ClN₂S·2ClH

InChI: InChI=1S/C11H11ClN2S.2ClH/c12-10-4-2-1-3-9(10)11-14-8(5-6-13)7-15-11;;/h1-4,7H,5-6,13H2;2*1H

InChI key: InChIKey=OOVQLRHNOJPUHE-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC=C1)C2=NC(CCN)=CS2.Cl

Synonyms:

• 4-Thiazoleethanamine, 2-(2-chlorophenyl)-, hydrochloride (1:2)

2-[2-(2-Chlorophenyl)-1,3-thiazol-4-yl]ethan-1-amine dihydrochloride

CAS: 1423031-11-1

Versatile small molecule scaffold

Formula: C₁₁H₁₃Cl₃N₂S

Purity: Min. 95%

Molecular weight: 311.7 g/mol

Ref: 3D-YGC03111