CAS 1423031-33-7

1,2,4-Oxadiazole-3-methanamine, α,5-dimethyl-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-3-methanamine, α,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring structure, which contributes to its potential biological activity. The presence of the methanamine group suggests it may exhibit amine-like reactivity, while the α,5-dimethyl substitution indicates steric hindrance that could influence its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its usability in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, typical of many oxadiazole derivatives. Its molecular structure allows for potential interactions with receptors or enzymes, making it a candidate for drug development. However, specific biological activities and safety profiles would require further investigation through experimental studies. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and material science.

Formula: C₅H₉N₃O·ClH

InChI: InChI=1S/C5H9N3O.ClH/c1-3(6)5-7-4(2)9-8-5;/h3H,6H2,1-2H3;1H

InChI key: InChIKey=YRFQYNOIIKXUJM-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=C(C)ON1.Cl

Synonyms:

• 1,2,4-Oxadiazole-3-methanamine, α,5-dimethyl-, hydrochloride (1:1)
• 1-(5-Methyl-1,2,4-oxadiazol-3-yl)ethan-1-amine hydrochloride

1-(5-Methyl-1,2,4-oxadiazol-3-yl)ethan-1-amine hydrochloride

CAS: 1423031-33-7

Versatile small molecule scaffold

Formula: C₅H₁₀ClN₃O

Purity: Min. 95%

Molecular weight: 163.6 g/mol

Ref: 3D-YGC03133