CAS 1423031-38-2

Benzenemethanamine, 3-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its amine and triazole functional groups, which contribute to its potential biological activity. The presence of the benzenemethanamine structure suggests that it may exhibit aromatic properties, while the triazole ring can enhance its pharmacological profile, possibly influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water than its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the amine group, and its triazole moiety may impart unique reactivity or binding characteristics. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to elucidate its specific applications, mechanisms of action, and potential therapeutic uses.

Formula: C₁₀H₁₂N₄·ClH

InChI: InChI=1S/C10H12N4.ClH/c1-7-12-10(14-13-7)9-4-2-3-8(5-9)6-11;/h2-5H,6,11H2,1H3,(H,12,13,14);1H

InChI key: InChIKey=RHJMBXHNZYQVOE-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(C=CC1)C=2NC(C)=NN2.Cl

Synonyms:

• Benzenemethanamine, 3-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1)

[3-(5-Methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine hydrochloride

CAS: 1423031-38-2

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClN₄

Purity: Min. 95%

Molecular weight: 224.69 g/mol

Ref: 3D-YGC03138