CAS 1423031-50-8

1H-1,2,4-Triazole, 3-phenyl-5-(2-pyrrolidinyl)-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole, 3-phenyl-5-(2-pyrrolidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a phenyl group and a pyrrolidine moiety, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in aqueous environments, which is often beneficial for pharmacological applications. The presence of the pyrrolidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit various properties, including potential antimicrobial or antifungal activities, although specific biological effects would depend on further empirical studies. Its CAS number, 1423031-50-8, allows for precise identification in chemical databases, facilitating research and development in various fields, including pharmaceuticals and agrochemicals. As with any chemical, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₄N₄·ClH

InChI: InChI=1S/C12H14N4.ClH/c1-2-5-9(6-3-1)11-14-12(16-15-11)10-7-4-8-13-10;/h1-3,5-6,10,13H,4,7-8H2,(H,14,15,16);1H

InChI key: InChIKey=KXWYCWCPQKEEBK-UHFFFAOYSA-N

SMILES: C=1(NC(=NN1)C2=CC=CC=C2)C3CCCN3.Cl

Synonyms:

• 1H-1,2,4-Triazole, 3-phenyl-5-(2-pyrrolidinyl)-, hydrochloride (1:1)

3-Phenyl-5-(pyrrolidin-2-yl)-1H-1,2,4-triazole hydrochloride

CAS: 1423031-50-8

Versatile small molecule scaffold

Formula: C₁₂H₁₅ClN₄

Purity: Min. 95%

Molecular weight: 250.73 g/mol

Ref: 3D-YGC03150