CAS 1423031-76-8

2-[[1-(Bromomethyl)cyclopentyl]methyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[[1-(Bromomethyl)cyclopentyl]methyl]-1H-isoindole-1,3(2H)-dione is a chemical compound characterized by its complex structure, which includes an isoindole core and a bromomethyl-substituted cyclopentyl group. This compound features a bicyclic structure that contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the bromomethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. The isoindole moiety is known for its biological activity, which may indicate potential pharmacological properties. Additionally, the compound's molecular weight, solubility, and stability under various conditions would be important factors to consider for practical applications. As with many organic compounds, safety data, including toxicity and handling precautions, should be reviewed before use. Overall, this compound represents a fascinating area of study within the field of organic chemistry, particularly in the context of drug development and synthetic methodologies.

Formula: C₁₅H₁₆BrNO₂

InChI: InChI=1S/C15H16BrNO2/c16-9-15(7-3-4-8-15)10-17-13(18)11-5-1-2-6-12(11)14(17)19/h1-2,5-6H,3-4,7-10H2

InChI key: InChIKey=JJADIYQCHDYFJA-UHFFFAOYSA-N

SMILES: C(N1C(=O)C=2C(C1=O)=CC=CC2)C3(CBr)CCCC3

Synonyms:

• 2-[[1-(Bromomethyl)cyclopentyl]methyl]-1H-isoindole-1,3(2H)-dione
• 1H-Isoindole-1,3(2H)-dione, 2-[[1-(bromomethyl)cyclopentyl]methyl]-

2-{[1-(Bromomethyl)cyclopentyl]methyl}-2,3-dihydro-1H-isoindole-1,3-dione

CAS: 1423031-76-8

Versatile small molecule scaffold

Formula: C₁₅H₁₆BrNO₂

Purity: Min. 95%

Molecular weight: 322.2 g/mol

Ref: 3D-YGC03176