CAS 1423031-86-0

Piperidine, 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the 3-cycloheptyl-1,2,4-oxadiazol-5-yl group indicates that this compound features a cycloheptyl substituent and an oxadiazole moiety, which can contribute to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for biological targets or having implications in drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the presence of functional groups. Further studies would be necessary to elucidate its complete profile, including any therapeutic effects or toxicity.

Formula: C₁₅H₂₅N₃O·ClH

InChI: InChI=1S/C15H25N3O.ClH/c1-2-4-8-13(7-3-1)15-17-14(19-18-15)10-12-6-5-9-16-11-12;/h12-13,16H,1-11H2;1H

InChI key: InChIKey=DJHJJXJMCFWOHX-UHFFFAOYSA-N

SMILES: C(C1=NC(=NO1)C2CCCCCC2)C3CCCNC3.Cl

Synonyms:

• Piperidine, 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

3-[(3-Cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]piperidine hydrochloride

CAS: 1423031-86-0

Versatile small molecule scaffold

Formula: C₁₅H₂₆ClN₃O

Purity: Min. 95%

Molecular weight: 299.84 g/mol

Ref: 3D-YGC03186