CAS 1423031-92-8

2-Propanamine, 2-methyl-1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-, hydrochloride (1:1)

Description:

2-Propanamine, 2-methyl-1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-, hydrochloride (1:1), with CAS number 1423031-92-8, is a chemical compound characterized by its amine functional group and a pyridine ring substituted with a trifluoromethyl group. This compound is typically a white to off-white solid in its hydrochloride salt form, which enhances its solubility in water. The presence of the trifluoromethyl group contributes to its unique electronic properties, potentially influencing its reactivity and interactions in biological systems. As an amine, it may exhibit basicity and can participate in hydrogen bonding, making it relevant in various chemical and pharmaceutical applications. Its structure suggests potential uses in medicinal chemistry, particularly in the development of compounds with specific biological activities. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₃F₃N₂O·ClH

InChI: InChI=1S/C10H13F3N2O.ClH/c1-9(2,14)6-16-8-4-3-7(5-15-8)10(11,12)13;/h3-5H,6,14H2,1-2H3;1H

InChI key: InChIKey=LRJZGQKMAIPFRA-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=CC(OCC(C)(C)N)=NC1.Cl

Synonyms:

• 2-Propanamine, 2-methyl-1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-, hydrochloride (1:1)

2-(2-Amino-2-methylpropoxy)-5-(trifluoromethyl)pyridine hydrochloride

CAS: 1423031-92-8

Versatile small molecule scaffold

Formula: C₁₀H₁₄ClF₃N₂O

Purity: Min. 95%

Molecular weight: 270.68 g/mol

Ref: 3D-YGC03192