CAS 1423032-06-7

Ethanone, 1-[3-[(methylamino)methyl]-1-pyrrolidinyl]-, hydrochloride (1:1)

Description:

Ethanone, 1-[3-[(methylamino)methyl]-1-pyrrolidinyl]-, hydrochloride (1:1), identified by CAS number 1423032-06-7, is a chemical compound that features a pyrrolidine ring substituted with a methylamino group and an ethanone moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the pyrrolidine structure suggests potential psychoactive properties, as many compounds with similar frameworks are known to interact with neurotransmitter systems. Its molecular structure indicates that it may exhibit characteristics such as moderate to high polarity due to the functional groups present, which can influence its reactivity and interaction with biological systems. Additionally, the hydrochloride form often implies that the compound may be used in pharmaceutical contexts, potentially as a precursor or active ingredient in drug formulations. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or regulatory considerations associated with its use.

Formula: C₈H₁₆N₂O·ClH

InChI: InChI=1S/C8H16N2O.ClH/c1-7(11)10-4-3-8(6-10)5-9-2;/h8-9H,3-6H2,1-2H3;1H

InChI key: InChIKey=CWHJBNSUXWNOSD-UHFFFAOYSA-N

SMILES: C(C)(=O)N1CC(CNC)CC1.Cl

Synonyms:

• Ethanone, 1-[3-[(methylamino)methyl]-1-pyrrolidinyl]-, hydrochloride (1:1)

1-{3-[(Methylamino)methyl]pyrrolidin-1-yl}ethan-1-one hydrochloride

CAS: 1423032-06-7

Versatile small molecule scaffold

Formula: C₈H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 192.68 g/mol

Ref: 3D-YGC03206