CAS 1423032-15-8

Benzenepropanoic acid, α-(aminomethyl)-2-methoxy-, hydrochloride (1:1)

Description:

Benzenepropanoic acid, α-(aminomethyl)-2-methoxy-, hydrochloride (1:1), with CAS number 1423032-15-8, is a chemical compound characterized by its structure, which includes a benzene ring, a propanoic acid moiety, and an aminomethyl group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the methoxy group contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is often used in pharmaceutical applications, where it may serve as an intermediate or active ingredient in drug formulations. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Safety data should also be consulted, as with any chemical, to understand its handling, storage, and potential hazards.

Formula: C₁₁H₁₅NO₃·ClH

InChI: InChI=1S/C11H15NO3.ClH/c1-15-10-5-3-2-4-8(10)6-9(7-12)11(13)14;/h2-5,9H,6-7,12H2,1H3,(H,13,14);1H

InChI key: InChIKey=CLIARHHGVZZQIY-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)CN)C1=C(OC)C=CC=C1.Cl

Synonyms:

• Benzenepropanoic acid, α-(aminomethyl)-2-methoxy-, hydrochloride (1:1)

3-Amino-2-[(2-methoxyphenyl)methyl]propanoic acid hydrochloride

CAS: 1423032-15-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 245.7 g/mol

Ref: 3D-YGC03215