CAS 1423032-22-7

4-Pyridinemethanamine, 2-propoxy-, hydrochloride (1:2)

Description:

4-Pyridinemethanamine, 2-propoxy-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. The presence of the propoxy group enhances its solubility in organic solvents and may influence its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on its interaction with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of therapeutic agents. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 4-Pyridinemethanamine, 2-propoxy-, hydrochloride (1:2) represents a versatile compound with potential applications in research and industry.

Formula: C₉H₁₄N₂O·2ClH

InChI: InChI=1S/C9H14N2O.2ClH/c1-2-5-12-9-6-8(7-10)3-4-11-9;;/h3-4,6H,2,5,7,10H2,1H3;2*1H

InChI key: InChIKey=OBPPUAAEFXGPKH-UHFFFAOYSA-N

SMILES: O(CCC)C1=CC(CN)=CC=N1.Cl

Synonyms:

• 4-Pyridinemethanamine, 2-propoxy-, hydrochloride (1:2)

(2-Propoxypyridin-4-yl)methanamine dihydrochloride

CAS: 1423032-22-7

Versatile small molecule scaffold

Formula: C₉H₁₆Cl₂N₂O

Purity: Min. 95%

Molecular weight: 239.14 g/mol

Ref: 3D-YGC03222