CAS 1423032-43-2

Cyclohexanecarboxylic acid, 1,4-diamino-, hydrochloride (1:2)

Description:

Cyclohexanecarboxylic acid, 1,4-diamino-, hydrochloride (1:2) is a chemical compound characterized by its cyclic structure and the presence of both carboxylic acid and amino functional groups. This compound typically appears as a white to off-white crystalline solid, indicating its solid-state at room temperature. The presence of the hydrochloride indicates that it is a salt formed from the reaction of the base (the amine) with hydrochloric acid, which enhances its solubility in water. The compound is likely to exhibit basic properties due to the amino groups, while the carboxylic acid contributes acidic characteristics. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active molecules or as intermediates in organic synthesis. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₁₄N₂O₂·2ClH

InChI: InChI=1S/C7H14N2O2.2ClH/c8-5-1-3-7(9,4-2-5)6(10)11;;/h5H,1-4,8-9H2,(H,10,11);2*1H

InChI key: InChIKey=NFXKUNFMUUKFDP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)CCC(N)CC1.Cl

Synonyms:

• Cyclohexanecarboxylic acid, 1,4-diamino-, hydrochloride (1:2)

1,4-Diaminocyclohexane-1-carboxylic acid dihydrochloride

CAS: 1423032-43-2

Versatile small molecule scaffold

Formula: C₇H₁₆Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 231.12 g/mol

Ref: 3D-YGC03243